C34H44N4O3 — CID 142408235
3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[2-(2,3,5,6-tetramethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid (PubChem CID 142408235) has the molecular formula C34H44N4O3 and a molecular weight of 556.75 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[2-(2,3,5,6-tetramethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[2-(2,3,5,6-tetramethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid |
|---|---|
| PubChem CID | 142408235 |
| Molecular Formula | C34H44N4O3 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[2-(2,3,5,6-tetramethylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]propanoic acid |
| SMILES | CCN(N)c1ccc(C(c2ccc3c(c2)CN(C(=O)c2c(C)c(C)cc(C)c2C)CC3)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C34H44N4O3/c1-9-38(36)28-13-12-27(23(6)31(28)35)30(34(7,8)33(40)41)25-11-10-24-14-15-37(18-26(24)17-25)32(39)29-21(4)19(2)16-20(3)22(29)5/h10-13,16-17,30H,9,14-15,18,35-36H2,1-8H3,(H,40,41) |
| InChIKey | JRINSVACDFYMHG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|