C33H44N4O3 — CID 142408115
ethane;ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(2-benzoyl-4-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoate (PubChem CID 142408115) has the molecular formula C33H44N4O3 and a molecular weight of 544.74 g/mol. Its IUPAC name is ethane;ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(2-benzoyl-4-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoate.
| Compound Name | ethane;ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(2-benzoyl-4-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoate |
|---|---|
| PubChem CID | 142408115 |
| Molecular Formula | C33H44N4O3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | ethane;ethyl 3-[3-amino-4-[amino(ethyl)amino]-2-methylphenyl]-3-(2-benzoyl-4-methyl-3,4-dihydro-1H-isoquinolin-7-yl)propanoate |
| SMILES | CC.CCOC(=O)CC(c1ccc2c(c1)CN(C(=O)c1ccccc1)CC2C)c1ccc(N(N)CC)c(N)c1C |
| InChI | InChI=1S/C31H38N4O3.C2H6/c1-5-35(33)28-15-14-26(21(4)30(28)32)27(17-29(36)38-6-2)23-12-13-25-20(3)18-34(19-24(25)16-23)31(37)22-10-8-7-9-11-22;1-2/h7-16,20,27H,5-6,17-19,32-33H2,1-4H3;1-2H3 |
| InChIKey | FBLNXGCXVQOLGT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|