C30H43N5O3 — CID 155348771
(3R)-3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[3-(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)-2,3-dihydro-1H-inden-5-yl]propanoic acid (PubChem CID 155348771) has the molecular formula C30H43N5O3 and a molecular weight of 521.71 g/mol. Its IUPAC name is (3R)-3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[3-(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)-2,3-dihydro-1H-inden-5-yl]propanoic acid.
| Compound Name | (3R)-3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[3-(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)-2,3-dihydro-1H-inden-5-yl]propanoic acid |
|---|---|
| PubChem CID | 155348771 |
| Molecular Formula | C30H43N5O3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | (3R)-3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[3-(4,6,6-trimethyl-3-oxo-1,4-diazepan-1-yl)-2,3-dihydro-1H-inden-5-yl]propanoic acid |
| SMILES | Cc1c([C@@H](c2ccc3c(c2)C(N2CC(=O)N(C)CC(C)(C)C2)CC3)C(C)(C)C(=O)O)ccc(N(C)N)c1N |
| InChI | InChI=1S/C30H43N5O3/c1-18-21(11-13-24(27(18)31)34(7)32)26(30(4,5)28(37)38)20-9-8-19-10-12-23(22(19)14-20)35-15-25(36)33(6)16-29(2,3)17-35/h8-9,11,13-14,23,26H,10,12,15-17,31-32H2,1-7H3,(H,37,38)/t23?,26-/m1/s1 |
| InChIKey | QXDNDCWSVLILFT-ANWICMFUSA-N |
| XLogP | 3.92 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|