C24H32ClN3O2 — CID 146413001
methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate (PubChem CID 146413001) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146413001 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | methyl 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccc(C)c(CCl)c1)c1ccc(N(N)C2CC2)c(N)c1C |
| InChI | InChI=1S/C24H32ClN3O2/c1-14-6-7-16(12-17(14)13-25)21(24(3,4)23(29)30-5)19-10-11-20(22(26)15(19)2)28(27)18-8-9-18/h6-7,10-12,18,21H,8-9,13,26-27H2,1-5H3 |
| InChIKey | IREDYWAWWHPBBF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|