C20H25ClFN3O2 — CID 145208416
ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate (PubChem CID 145208416) has the molecular formula C20H25ClFN3O2 and a molecular weight of 393.89 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 145208416 |
| Molecular Formula | C20H25ClFN3O2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(F)c(CCl)c1)c1ccc(N(C)N)c(N)c1C |
| InChI | InChI=1S/C20H25ClFN3O2/c1-4-27-19(26)10-16(13-5-7-17(22)14(9-13)11-21)15-6-8-18(25(3)24)20(23)12(15)2/h5-9,16H,4,10-11,23-24H2,1-3H3 |
| InChIKey | LITJQDDRZGZNBE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|