C21H28FN3O2 — CID 155179032
3-[3-amino-4-[amino(ethyl)amino]-2-fluorophenyl]-3-(3-ethyl-4-methylphenyl)-2-methylpropanoic acid (PubChem CID 155179032) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(ethyl)amino]-2-fluorophenyl]-3-(3-ethyl-4-methylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-[3-amino-4-[amino(ethyl)amino]-2-fluorophenyl]-3-(3-ethyl-4-methylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 155179032 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-[3-amino-4-[amino(ethyl)amino]-2-fluorophenyl]-3-(3-ethyl-4-methylphenyl)-2-methylpropanoic acid |
| SMILES | CCc1cc(C(c2ccc(N(N)CC)c(N)c2F)C(C)C(=O)O)ccc1C |
| InChI | InChI=1S/C21H28FN3O2/c1-5-14-11-15(8-7-12(14)3)18(13(4)21(26)27)16-9-10-17(25(24)6-2)20(23)19(16)22/h7-11,13,18H,5-6,23-24H2,1-4H3,(H,26,27) |
| InChIKey | ZJHCXXAMVKJEFM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|