C21H26ClN3O2 — CID 123482486
ethyl 3-[3-(chloromethyl)-4-methylphenyl]-3-[3-diazenyl-5-methyl-4-(methylamino)phenyl]propanoate (PubChem CID 123482486) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is ethyl 3-[3-(chloromethyl)-4-methylphenyl]-3-[3-diazenyl-5-methyl-4-(methylamino)phenyl]propanoate.
| Compound Name | ethyl 3-[3-(chloromethyl)-4-methylphenyl]-3-[3-diazenyl-5-methyl-4-(methylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 123482486 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 3-[3-(chloromethyl)-4-methylphenyl]-3-[3-diazenyl-5-methyl-4-(methylamino)phenyl]propanoate |
| SMILES | [H]/N=N/c1cc(C(CC(=O)OCC)c2ccc(C)c(CCl)c2)cc(C)c1NC |
| InChI | InChI=1S/C21H26ClN3O2/c1-5-27-20(26)11-18(15-7-6-13(2)17(9-15)12-22)16-8-14(3)21(24-4)19(10-16)25-23/h6-10,18,23-24H,5,11-12H2,1-4H3/b25-23+ |
| InChIKey | AKPMISSIAZKICL-WJTDDFOZSA-N |
| XLogP | 5.83 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|