C25H33N3O2 — CID 145208610
ethyl (3R)-3-[3-(cyclopropen-1-ylmethyl)-4-methylphenyl]-3-[4-(ethylamino)-3-hydrazinyl-2-methylphenyl]propanoate (PubChem CID 145208610) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is ethyl (3R)-3-[3-(cyclopropen-1-ylmethyl)-4-methylphenyl]-3-[4-(ethylamino)-3-hydrazinyl-2-methylphenyl]propanoate.
| Compound Name | ethyl (3R)-3-[3-(cyclopropen-1-ylmethyl)-4-methylphenyl]-3-[4-(ethylamino)-3-hydrazinyl-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 145208610 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | ethyl (3R)-3-[3-(cyclopropen-1-ylmethyl)-4-methylphenyl]-3-[4-(ethylamino)-3-hydrazinyl-2-methylphenyl]propanoate |
| SMILES | CCNc1ccc([C@H](CC(=O)OCC)c2ccc(C)c(CC3=CC3)c2)c(C)c1NN |
| InChI | InChI=1S/C25H33N3O2/c1-5-27-23-12-11-21(17(4)25(23)28-26)22(15-24(29)30-6-2)19-10-7-16(3)20(14-19)13-18-8-9-18/h7-8,10-12,14,22,27-28H,5-6,9,13,15,26H2,1-4H3/t22-/m1/s1 |
| InChIKey | OMPFYTPFTSOCPN-JOCHJYFZSA-N |
| XLogP | 4.98 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|