C24H30N3O — CID 142605309
CID 142605309 (PubChem CID 142605309) has the molecular formula C24H30N3O and a molecular weight of 376.52 g/mol.
| Compound Name | CID 142605309 |
|---|---|
| PubChem CID | 142605309 |
| Molecular Formula | C24H30N3O |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | — |
| SMILES | CCNc1ccc([C@@H](CC(=O)C2=C[CH]2)c2ccc(C)c(CC)c2)c(C)c1NN |
| InChI | InChI=1S/C24H30N3O/c1-5-17-13-19(8-7-15(17)3)21(14-23(28)18-9-10-18)20-11-12-22(26-6-2)24(27-25)16(20)4/h7-13,21,26-27H,5-6,14,25H2,1-4H3/t21-/m0/s1 |
| InChIKey | QXCYBGUMAGGCFZ-NRFANRHFSA-N |
| XLogP | 4.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|