C33H42FN4O3S — CID 142376425
CID 142376425 (PubChem CID 142376425) has the molecular formula C33H42FN4O3S and a molecular weight of 593.79 g/mol.
| Compound Name | CID 142376425 |
|---|---|
| PubChem CID | 142376425 |
| Molecular Formula | C33H42FN4O3S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | — |
| SMILES | CCNc1ccc([C@@H](CC(=O)C2=C[CH]2)c2ccc(C)c(CN3C[C@@H](C)Cc4ccc(F)cc4S3(=O)=O)c2)c(C)c1N.N.[H][H] |
| InChI | InChI=1S/C33H37FN3O3S.H3N.H2/c1-5-36-30-13-12-28(22(4)33(30)35)29(17-31(38)23-8-9-23)24-7-6-21(3)26(15-24)19-37-18-20(2)14-25-10-11-27(34)16-32(25)41(37,39)40;;/h6-13,15-16,20,29,36H,5,14,17-19,35H2,1-4H3;1H3;1H/t20-,29-;;/m0../s1 |
| InChIKey | VZTZQGSULIDKIP-WFZWKPHKSA-N |
| XLogP | 6.48 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|