C38H48N5O — CID 145208776
CID 145208776 (PubChem CID 145208776) has the molecular formula C38H48N5O and a molecular weight of 590.84 g/mol.
| Compound Name | CID 145208776 |
|---|---|
| PubChem CID | 145208776 |
| Molecular Formula | C38H48N5O |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | — |
| SMILES | CCNc1ccc([C@@H](c2ccc(C)c(CN3Cc4cnccc4C4C=C4[C@H](CC)C3)c2)C(C)(C)C(=O)C2=C[CH]2)c(C)c1NN.[H][H] |
| InChI | InChI=1S/C38H46N5O.H2/c1-7-25-20-43(22-29-19-40-16-15-31(29)33-18-32(25)33)21-28-17-27(10-9-23(28)3)35(38(5,6)37(44)26-11-12-26)30-13-14-34(41-8-2)36(42-39)24(30)4;/h9-19,25,33,35,41-42H,7-8,20-22,39H2,1-6H3;1H/t25-,33?,35-;/m1./s1 |
| InChIKey | OJBZWWCNCLLDNI-SSJRLPAYSA-N |
| XLogP | 7.60 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|