C35H40N4O3 — CID 155363612
3-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-(spiro[3,5-dihydropyrido[2,3-h][1,4]benzoxazepine-2,1'-cyclopropane]-4-ylmethyl)phenyl]propanoic acid (PubChem CID 155363612) has the molecular formula C35H40N4O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is 3-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-(spiro[3,5-dihydropyrido[2,3-h][1,4]benzoxazepine-2,1'-cyclopropane]-4-ylmethyl)phenyl]propanoic acid.
| Compound Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-(spiro[3,5-dihydropyrido[2,3-h][1,4]benzoxazepine-2,1'-cyclopropane]-4-ylmethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 155363612 |
| Molecular Formula | C35H40N4O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-[4-methyl-3-(spiro[3,5-dihydropyrido[2,3-h][1,4]benzoxazepine-2,1'-cyclopropane]-4-ylmethyl)phenyl]propanoic acid |
| SMILES | CNc1ccc(C(c2ccc(C)c(CN3Cc4cc5ncccc5cc4OC4(CC4)C3)c2)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C35H40N4O3/c1-21-8-9-24(31(34(3,4)33(40)41)27-10-11-28(37-5)32(36)22(27)2)15-25(21)18-39-19-26-16-29-23(7-6-14-38-29)17-30(26)42-35(20-39)12-13-35/h6-11,14-17,31,37H,12-13,18-20,36H2,1-5H3,(H,40,41) |
| InChIKey | YWEJQJGADVOMCB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|