C34H36ClN5O3 — CID 155730725
3-[4-chloro-3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid (PubChem CID 155730725) has the molecular formula C34H36ClN5O3 and a molecular weight of 598.15 g/mol. Its IUPAC name is 3-[4-chloro-3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-chloro-3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 155730725 |
| Molecular Formula | C34H36ClN5O3 |
| Molecular Weight | 598.15 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 3-[4-chloro-3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(c3ccc4c(nnn4C)c3C)C(C)(C)C(=O)O)ccc2Cl)Cc2cc3ncccc3cc2O1 |
| InChI | InChI=1S/C34H36ClN5O3/c1-6-25-19-40(18-24-15-28-21(8-7-13-36-28)16-30(24)43-25)17-23-14-22(9-11-27(23)35)31(34(3,4)33(41)42)26-10-12-29-32(20(26)2)37-38-39(29)5/h7-16,25,31H,6,17-19H2,1-5H3,(H,41,42)/t25-,31?/m1/s1 |
| InChIKey | TXYMHQFMOYLZND-KZQYXEPFSA-N |
| XLogP | 6.89 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.15 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |