C30H35ClN4O5S — CID 135123522
3-[4-chloro-3-[(4-ethyl-1,1-dihydroxy-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid (PubChem CID 135123522) has the molecular formula C30H35ClN4O5S and a molecular weight of 599.15 g/mol. Its IUPAC name is 3-[4-chloro-3-[(4-ethyl-1,1-dihydroxy-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-chloro-3-[(4-ethyl-1,1-dihydroxy-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 135123522 |
| Molecular Formula | C30H35ClN4O5S |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 3-[4-chloro-3-[(4-ethyl-1,1-dihydroxy-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]phenyl]-3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethylpropanoic acid |
| SMILES | CCC1CN(Cc2cc(C(c3ccc4c(nnn4C)c3C)C(C)(C)C(=O)O)ccc2Cl)S(O)(O)c2ccccc2O1 |
| InChI | InChI=1S/C30H35ClN4O5S/c1-6-21-17-35(41(38,39)26-10-8-7-9-25(26)40-21)16-20-15-19(11-13-23(20)31)27(30(3,4)29(36)37)22-12-14-24-28(18(22)2)32-33-34(24)5/h7-15,21,27,38-39H,6,16-17H2,1-5H3,(H,36,37) |
| InChIKey | QZGXVLNMHCBNKC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |