C35H39N5O4 — CID 155730589
3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]-4-methoxyphenyl]-2,2-dimethylpropanoic acid (PubChem CID 155730589) has the molecular formula C35H39N5O4 and a molecular weight of 593.73 g/mol. Its IUPAC name is 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]-4-methoxyphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]-4-methoxyphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 155730589 |
| Molecular Formula | C35H39N5O4 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[2,3-h][1,4]benzoxazepin-4-yl]methyl]-4-methoxyphenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(c3ccc4c(nnn4C)c3C)C(C)(C)C(=O)O)ccc2OC)Cc2cc3ncccc3cc2O1 |
| InChI | InChI=1S/C35H39N5O4/c1-7-26-20-40(19-25-16-28-22(9-8-14-36-28)17-31(25)44-26)18-24-15-23(10-13-30(24)43-6)32(35(3,4)34(41)42)27-11-12-29-33(21(27)2)37-38-39(29)5/h8-17,26,32H,7,18-20H2,1-6H3,(H,41,42)/t26-,32?/m1/s1 |
| InChIKey | CMEUVTZBPVQIHJ-PSPFREQMSA-N |
| XLogP | 6.25 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |