C31H35F2N3O5 — CID 155364358
3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-[(2,2-difluoro-8,9-dihydro-6H-[1,3]dioxolo[4,5-i][1,4]benzoxazepin-7-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 155364358) has the molecular formula C31H35F2N3O5 and a molecular weight of 567.63 g/mol. Its IUPAC name is 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-[(2,2-difluoro-8,9-dihydro-6H-[1,3]dioxolo[4,5-i][1,4]benzoxazepin-7-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-[(2,2-difluoro-8,9-dihydro-6H-[1,3]dioxolo[4,5-i][1,4]benzoxazepin-7-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 155364358 |
| Molecular Formula | C31H35F2N3O5 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-[(2,2-difluoro-8,9-dihydro-6H-[1,3]dioxolo[4,5-i][1,4]benzoxazepin-7-yl)methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | CNc1ccc(C(c2ccc(C)c(CN3CCOc4c(ccc5c4OC(F)(F)O5)C3)c2)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C31H35F2N3O5/c1-17-6-7-19(25(30(3,4)29(37)38)22-9-10-23(35-5)26(34)18(22)2)14-21(17)16-36-12-13-39-27-20(15-36)8-11-24-28(27)41-31(32,33)40-24/h6-11,14,25,35H,12-13,15-16,34H2,1-5H3,(H,37,38) |
| InChIKey | BZMOTRBTCYYWAV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|