C32H39N5O3 — CID 163684801
(3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-[(3R)-3-[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-2,2-dimethylpropanoic acid (PubChem CID 163684801) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-[(3R)-3-[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-2,2-dimethylpropanoic acid.
| Compound Name | (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-[(3R)-3-[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 163684801 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-[(3R)-3-[(2R)-2-ethyl-3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-2,2-dimethylpropanoic acid |
| SMILES | [H]/N=N/c1c(NC)ccc([C@H](c2ccc3c(c2)[C@H](N2Cc4cnccc4O[C@H](CC)C2)CC3)C(C)(C)C(=O)O)c1C |
| InChI | InChI=1S/C32H39N5O3/c1-6-23-18-37(17-22-16-35-14-13-28(22)40-23)27-12-9-20-7-8-21(15-25(20)27)29(32(3,4)31(38)39)24-10-11-26(34-5)30(36-33)19(24)2/h7-8,10-11,13-16,23,27,29,33-34H,6,9,12,17-18H2,1-5H3,(H,38,39)/b36-33+/t23-,27-,29+/m1/s1 |
| InChIKey | JNXVLVTUGOBMNZ-VFENOPQDSA-N |
| XLogP | 7.00 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|