C33H38N4O3 — CID 134588421
methyl 3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethyl-3-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]propanoate (PubChem CID 134588421) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is methyl 3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethyl-3-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]propanoate.
| Compound Name | methyl 3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethyl-3-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]propanoate |
|---|---|
| PubChem CID | 134588421 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | methyl 3-(1,4-dimethylbenzotriazol-5-yl)-2,2-dimethyl-3-[3-(2-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2,3-dihydro-1H-inden-5-yl]propanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccc2c(c1)C(N1Cc3ccccc3OC(C)C1)CC2)c1ccc2c(nnn2C)c1C |
| InChI | InChI=1S/C33H38N4O3/c1-20-18-37(19-24-9-7-8-10-29(24)40-20)27-15-13-22-11-12-23(17-26(22)27)30(33(3,4)32(38)39-6)25-14-16-28-31(21(25)2)34-35-36(28)5/h7-12,14,16-17,20,27,30H,13,15,18-19H2,1-6H3 |
| InChIKey | IOWQJMJRHHCTLO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |