C33H36N4O5 — CID 155071755
formyl 3-[3-[(2R)-2,7-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-3-(7-methoxy-1,4-dimethylbenzotriazol-5-yl)propanoate (PubChem CID 155071755) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is formyl 3-[3-[(2R)-2,7-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-3-(7-methoxy-1,4-dimethylbenzotriazol-5-yl)propanoate.
| Compound Name | formyl 3-[3-[(2R)-2,7-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-3-(7-methoxy-1,4-dimethylbenzotriazol-5-yl)propanoate |
|---|---|
| PubChem CID | 155071755 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | formyl 3-[3-[(2R)-2,7-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2,3-dihydro-1H-inden-5-yl]-3-(7-methoxy-1,4-dimethylbenzotriazol-5-yl)propanoate |
| SMILES | COc1cc(C(CC(=O)OC=O)c2ccc3c(c2)C(N2Cc4cc(C)ccc4O[C@H](C)C2)CC3)c(C)c2nnn(C)c12 |
| InChI | InChI=1S/C33H36N4O5/c1-19-6-11-29-24(12-19)17-37(16-20(2)42-29)28-10-9-22-7-8-23(13-27(22)28)26(15-31(39)41-18-38)25-14-30(40-5)33-32(21(25)3)34-35-36(33)4/h6-8,11-14,18,20,26,28H,9-10,15-17H2,1-5H3/t20-,26?,28?/m1/s1 |
| InChIKey | QCNXRRHPZBUGAG-JRHFUVFWSA-N |
| XLogP | 5.09 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|