C32H39FN4O3 — CID 155179173
3-[3-diazenyl-4-(ethylamino)-2-fluorophenyl]-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]pentanoic acid (PubChem CID 155179173) has the molecular formula C32H39FN4O3 and a molecular weight of 546.69 g/mol. Its IUPAC name is 3-[3-diazenyl-4-(ethylamino)-2-fluorophenyl]-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]pentanoic acid.
| Compound Name | 3-[3-diazenyl-4-(ethylamino)-2-fluorophenyl]-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]pentanoic acid |
|---|---|
| PubChem CID | 155179173 |
| Molecular Formula | C32H39FN4O3 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 3-[3-diazenyl-4-(ethylamino)-2-fluorophenyl]-3-[3-[[(2R)-2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]methyl]-4-methylphenyl]pentanoic acid |
| SMILES | [H]/N=N/c1c(NCC)ccc(C(CC)(CC(=O)O)c2ccc(C)c(CN3Cc4ccccc4O[C@H](CC)C3)c2)c1F |
| InChI | InChI=1S/C32H39FN4O3/c1-5-25-20-37(18-22-10-8-9-11-28(22)40-25)19-23-16-24(13-12-21(23)4)32(6-2,17-29(38)39)26-14-15-27(35-7-3)31(36-34)30(26)33/h8-16,25,34-35H,5-7,17-20H2,1-4H3,(H,38,39)/b36-34+/t25-,32?/m1/s1 |
| InChIKey | DCSOYYDOCMKPDW-GDNXBUMUSA-N |
| XLogP | 7.57 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|