C28H40N4O3 — CID 145208472
(Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]hept-6-enoic acid (PubChem CID 145208472) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]hept-6-enoic acid.
| Compound Name | (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]hept-6-enoic acid |
|---|---|
| PubChem CID | 145208472 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[(2-ethyl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)methyl]-4-methylphenyl]hept-6-enoic acid |
| SMILES | CCC1CN(Cc2cc(C(CC/C(N)=C/N(N)CC)CC(=O)O)ccc2C)Cc2ccccc2O1 |
| InChI | InChI=1S/C28H40N4O3/c1-4-26-19-31(16-23-8-6-7-9-27(23)35-26)17-24-14-21(11-10-20(24)3)22(15-28(33)34)12-13-25(29)18-32(30)5-2/h6-11,14,18,22,26H,4-5,12-13,15-17,19,29-30H2,1-3H3,(H,33,34)/b25-18- |
| InChIKey | SUKZTDRXBMDRHZ-BWAHOGKJSA-N |
| XLogP | 4.50 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|