C29H40N4O5S — CID 152926291
ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-7-ethylimino-6-hydrazinylideneheptanoate (PubChem CID 152926291) has the molecular formula C29H40N4O5S and a molecular weight of 556.73 g/mol. Its IUPAC name is ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-7-ethylimino-6-hydrazinylideneheptanoate.
| Compound Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-7-ethylimino-6-hydrazinylideneheptanoate |
|---|---|
| PubChem CID | 152926291 |
| Molecular Formula | C29H40N4O5S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-7-ethylimino-6-hydrazinylideneheptanoate |
| SMILES | CC/N=C/C(CCC(CC(=O)OCC)c1ccc(C)c(CN2C[C@@H](CC)Oc3ccccc3S2(=O)=O)c1)=NN |
| InChI | InChI=1S/C29H40N4O5S/c1-5-26-20-33(39(35,36)28-11-9-8-10-27(28)38-26)19-24-16-22(13-12-21(24)4)23(17-29(34)37-7-3)14-15-25(32-30)18-31-6-2/h8-13,16,18,23,26H,5-7,14-15,17,19-20,30H2,1-4H3/b31-18+,32-25?/t23?,26-/m1/s1 |
| InChIKey | XDVVQMIZKYMSGA-JWWYVUDTSA-N |
| XLogP | 4.58 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|