C25H45N3O3S — CID 145208882
ethyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[[tert-butyl(dimethyl)-λ4-sulfanyl]oxymethyl]-4-methylphenyl]hept-6-enoate (PubChem CID 145208882) has the molecular formula C25H45N3O3S and a molecular weight of 467.72 g/mol. Its IUPAC name is ethyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[[tert-butyl(dimethyl)-λ4-sulfanyl]oxymethyl]-4-methylphenyl]hept-6-enoate.
| Compound Name | ethyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[[tert-butyl(dimethyl)-λ4-sulfanyl]oxymethyl]-4-methylphenyl]hept-6-enoate |
|---|---|
| PubChem CID | 145208882 |
| Molecular Formula | C25H45N3O3S |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | ethyl (Z)-6-amino-7-[amino(ethyl)amino]-3-[3-[[tert-butyl(dimethyl)-λ4-sulfanyl]oxymethyl]-4-methylphenyl]hept-6-enoate |
| SMILES | CCOC(=O)CC(CC/C(N)=C/N(N)CC)c1ccc(C)c(COS(C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H45N3O3S/c1-9-28(27)17-23(26)14-13-21(16-24(29)30-10-2)20-12-11-19(3)22(15-20)18-31-32(7,8)25(4,5)6/h11-12,15,17,21H,9-10,13-14,16,18,26-27H2,1-8H3/b23-17- |
| InChIKey | LLTGQHGEERQYSM-QJOMJCCJSA-N |
| XLogP | 5.10 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|