C18H26N4O3 — CID 151436603
ethyl 3-[4-(aminomethyl)-3-(hydroxymethyl)phenyl]-5-(1-methyltriazol-4-yl)pentanoate (PubChem CID 151436603) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 3-[4-(aminomethyl)-3-(hydroxymethyl)phenyl]-5-(1-methyltriazol-4-yl)pentanoate.
| Compound Name | ethyl 3-[4-(aminomethyl)-3-(hydroxymethyl)phenyl]-5-(1-methyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 151436603 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | ethyl 3-[4-(aminomethyl)-3-(hydroxymethyl)phenyl]-5-(1-methyltriazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(C)nn1)c1ccc(CN)c(CO)c1 |
| InChI | InChI=1S/C18H26N4O3/c1-3-25-18(24)9-14(6-7-17-11-22(2)21-20-17)13-4-5-15(10-19)16(8-13)12-23/h4-5,8,11,14,23H,3,6-7,9-10,12,19H2,1-2H3 |
| InChIKey | PDQCXHMOLCFZJY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |