C27H37N5O5S — CID 122653300
ethyl 3-[3-[(1,1-dihydroxy-4-methyl-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoate (PubChem CID 122653300) has the molecular formula C27H37N5O5S and a molecular weight of 543.69 g/mol. Its IUPAC name is ethyl 3-[3-[(1,1-dihydroxy-4-methyl-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoate.
| Compound Name | ethyl 3-[3-[(1,1-dihydroxy-4-methyl-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 122653300 |
| Molecular Formula | C27H37N5O5S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | ethyl 3-[3-[(1,1-dihydroxy-4-methyl-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(CC)nn1)c1ccc(C)c(CN2CC(C)Oc3cccnc3S2(O)O)c1 |
| InChI | InChI=1S/C27H37N5O5S/c1-5-31-18-24(29-30-31)12-11-22(15-26(33)36-6-2)21-10-9-19(3)23(14-21)17-32-16-20(4)37-25-8-7-13-28-27(25)38(32,34)35/h7-10,13-14,18,20,22,34-35H,5-6,11-12,15-17H2,1-4H3 |
| InChIKey | XASXUJRBKNYISN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |