C28H34F3N5O5S — CID 118170695
ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate (PubChem CID 118170695) has the molecular formula C28H34F3N5O5S and a molecular weight of 609.67 g/mol. Its IUPAC name is ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate.
| Compound Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 118170695 |
| Molecular Formula | C28H34F3N5O5S |
| Molecular Weight | 609.67 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | ethyl 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoate |
| SMILES | CCOC(=O)CC(CCc1cn(CC)nn1)c1ccc(C(F)(F)F)c(CN2C[C@@H](CC)Oc3ccncc3S2(=O)=O)c1 |
| InChI | InChI=1S/C28H34F3N5O5S/c1-4-23-18-36(42(38,39)26-15-32-12-11-25(26)41-23)16-21-13-19(8-10-24(21)28(29,30)31)20(14-27(37)40-6-3)7-9-22-17-35(5-2)34-33-22/h8,10-13,15,17,20,23H,4-7,9,14,16,18H2,1-3H3/t20?,23-/m1/s1 |
| InChIKey | BDIKWCIIBMABNG-GWQXNCQPSA-N |
| XLogP | 4.74 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |