C27H35N5O5S — CID 118170571
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-propyltriazol-4-yl)pentanoic acid (PubChem CID 118170571) has the molecular formula C27H35N5O5S and a molecular weight of 541.67 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-propyltriazol-4-yl)pentanoic acid.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-propyltriazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 118170571 |
| Molecular Formula | C27H35N5O5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-propyltriazol-4-yl)pentanoic acid |
| SMILES | CCCn1cc(CCC(CC(=O)O)c2ccc(C)c(CN3C[C@@H](CC)Oc4ccncc4S3(=O)=O)c2)nn1 |
| InChI | InChI=1S/C27H35N5O5S/c1-4-12-31-17-23(29-30-31)9-8-21(14-27(33)34)20-7-6-19(3)22(13-20)16-32-18-24(5-2)37-25-10-11-28-15-26(25)38(32,35)36/h6-7,10-11,13,15,17,21,24H,4-5,8-9,12,14,16,18H2,1-3H3,(H,33,34)/t21?,24-/m1/s1 |
| InChIKey | YHMSHUNSVHSTSR-MQNHUJCZSA-N |
| XLogP | 3.94 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |