C26H30F3N5O5S — CID 118170712
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid (PubChem CID 118170712) has the molecular formula C26H30F3N5O5S and a molecular weight of 581.62 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 118170712 |
| Molecular Formula | C26H30F3N5O5S |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CCc3cn(CC)nn3)CC(=O)O)ccc2C(F)(F)F)S(=O)(=O)c2cnccc2O1 |
| InChI | InChI=1S/C26H30F3N5O5S/c1-3-21-16-34(40(37,38)24-13-30-10-9-23(24)39-21)14-19-11-17(6-8-22(19)26(27,28)29)18(12-25(35)36)5-7-20-15-33(4-2)32-31-20/h6,8-11,13,15,18,21H,3-5,7,12,14,16H2,1-2H3,(H,35,36)/t18?,21-/m1/s1 |
| InChIKey | GNGJWPZEJKPGFY-BDPMCISCSA-N |
| XLogP | 4.26 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |