C25H31N5O5S — CID 118170323
5-(1-ethyltriazol-4-yl)-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]pentanoic acid (PubChem CID 118170323) has the molecular formula C25H31N5O5S and a molecular weight of 513.62 g/mol. Its IUPAC name is 5-(1-ethyltriazol-4-yl)-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]pentanoic acid.
| Compound Name | 5-(1-ethyltriazol-4-yl)-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 118170323 |
| Molecular Formula | C25H31N5O5S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 5-(1-ethyltriazol-4-yl)-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydropyrido[3,2-b][1,4,5]oxathiazepin-2-yl]methyl]phenyl]pentanoic acid |
| SMILES | CCn1cc(CCC(CC(=O)O)c2ccc(C)c(CN3C[C@@H](C)Oc4cccnc4S3(=O)=O)c2)nn1 |
| InChI | InChI=1S/C25H31N5O5S/c1-4-29-16-22(27-28-29)10-9-20(13-24(31)32)19-8-7-17(2)21(12-19)15-30-14-18(3)35-23-6-5-11-26-25(23)36(30,33)34/h5-8,11-12,16,18,20H,4,9-10,13-15H2,1-3H3,(H,31,32)/t18-,20?/m1/s1 |
| InChIKey | PPMXGPZSQLHUHK-QSVWIEALSA-N |
| XLogP | 3.16 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |