C24H32F2N4O4S — CID 135136888
(Z)-1-[amino(ethyl)amino]-3-[1-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-difluoropropoxy]prop-1-en-2-amine (PubChem CID 135136888) has the molecular formula C24H32F2N4O4S and a molecular weight of 510.61 g/mol. Its IUPAC name is (Z)-1-[amino(ethyl)amino]-3-[1-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-difluoropropoxy]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(ethyl)amino]-3-[1-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-difluoropropoxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 135136888 |
| Molecular Formula | C24H32F2N4O4S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (Z)-1-[amino(ethyl)amino]-3-[1-[3-[(1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-methylphenyl]-2,2-difluoropropoxy]prop-1-en-2-amine |
| SMILES | CCN(N)/C=C(\N)COC(c1ccc(C)c(CN2CCOc3ccccc3S2(=O)=O)c1)C(C)(F)F |
| InChI | InChI=1S/C24H32F2N4O4S/c1-4-29(28)15-20(27)16-34-23(24(3,25)26)18-10-9-17(2)19(13-18)14-30-11-12-33-21-7-5-6-8-22(21)35(30,31)32/h5-10,13,15,23H,4,11-12,14,16,27-28H2,1-3H3/b20-15- |
| InChIKey | PSNOPHMUCQKYLM-HKWRFOASSA-N |
| XLogP | 3.29 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|