C28H31FN2O4S2 — CID 167065518
3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 167065518) has the molecular formula C28H31FN2O4S2 and a molecular weight of 542.70 g/mol. Its IUPAC name is 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 167065518 |
| Molecular Formula | C28H31FN2O4S2 |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(c3cc(F)c(C(C)=O)s3)C(C)(C)C(=O)O)ccc2C)Sc2cnccc2O1 |
| InChI | InChI=1S/C28H31FN2O4S2/c1-6-20-15-31(37-24-13-30-10-9-22(24)35-20)14-19-11-18(8-7-16(19)2)25(28(4,5)27(33)34)23-12-21(29)26(36-23)17(3)32/h7-13,20,25H,6,14-15H2,1-5H3,(H,33,34)/t20-,25?/m1/s1 |
| InChIKey | SZLTVBGXTAQQMM-VGOKPJQXSA-N |
| XLogP | 6.72 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|