C29H32FNO6S2 — CID 155466795
3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 155466795) has the molecular formula C29H32FNO6S2 and a molecular weight of 573.71 g/mol. Its IUPAC name is 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 155466795 |
| Molecular Formula | C29H32FNO6S2 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 3-(5-acetyl-4-fluorothiophen-2-yl)-3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(c3cc(F)c(C(C)=O)s3)C(C)(C)C(=O)O)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C29H32FNO6S2/c1-6-21-16-31(39(35,36)25-10-8-7-9-23(25)37-21)15-20-13-19(12-11-17(20)2)26(29(4,5)28(33)34)24-14-22(30)27(38-24)18(3)32/h7-14,21,26H,6,15-16H2,1-5H3,(H,33,34)/t21-,26?/m1/s1 |
| InChIKey | VARRBXFJQLPPCL-OSMGYRLQSA-N |
| XLogP | 6.00 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |