C26H28N2O6S2 — CID 167320325
[2-(5-acetyl-1,3-thiazol-2-yl)-2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]ethyl] formate (PubChem CID 167320325) has the molecular formula C26H28N2O6S2 and a molecular weight of 528.65 g/mol. Its IUPAC name is [2-(5-acetyl-1,3-thiazol-2-yl)-2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]ethyl] formate.
| Compound Name | [2-(5-acetyl-1,3-thiazol-2-yl)-2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]ethyl] formate |
|---|---|
| PubChem CID | 167320325 |
| Molecular Formula | C26H28N2O6S2 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [2-(5-acetyl-1,3-thiazol-2-yl)-2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]ethyl] formate |
| SMILES | CC[C@@H]1CN(Cc2cc(C(COC=O)c3ncc(C(C)=O)s3)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C26H28N2O6S2/c1-4-21-14-28(36(31,32)25-8-6-5-7-23(25)34-21)13-20-11-19(10-9-17(20)2)22(15-33-16-29)26-27-12-24(35-26)18(3)30/h5-12,16,21-22H,4,13-15H2,1-3H3/t21-,22?/m1/s1 |
| InChIKey | PWBJOJWNSBKJFH-ZMFCMNQTSA-N |
| XLogP | 4.32 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|