C27H28N2O6S2 — CID 167320281
[2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)ethyl] formate (PubChem CID 167320281) has the molecular formula C27H28N2O6S2 and a molecular weight of 540.66 g/mol. Its IUPAC name is [2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)ethyl] formate.
| Compound Name | [2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)ethyl] formate |
|---|---|
| PubChem CID | 167320281 |
| Molecular Formula | C27H28N2O6S2 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [2-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-2-(6-oxo-4,5-dihydrothieno[2,3-c]pyrrol-2-yl)ethyl] formate |
| SMILES | CC[C@@H]1CN(Cc2cc(C(COC=O)c3cc4c(s3)C(=O)NC4)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C27H28N2O6S2/c1-3-21-14-29(37(32,33)25-7-5-4-6-23(25)35-21)13-20-10-18(9-8-17(20)2)22(15-34-16-30)24-11-19-12-28-27(31)26(19)36-24/h4-11,16,21-22H,3,12-15H2,1-2H3,(H,28,31)/t21-,22?/m1/s1 |
| InChIKey | WVZJSKSFCYPPAK-ZMFCMNQTSA-N |
| XLogP | 3.97 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|