C30H41ClN4O3S — CID 135142420
(Z)-6-amino-7-[amino(cyclobutyl)amino]-3-[4-chloro-3-[[(4R)-4-ethyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]-2,2-dimethylhept-6-enoic acid (PubChem CID 135142420) has the molecular formula C30H41ClN4O3S and a molecular weight of 573.20 g/mol. Its IUPAC name is (Z)-6-amino-7-[amino(cyclobutyl)amino]-3-[4-chloro-3-[[(4R)-4-ethyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]-2,2-dimethylhept-6-enoic acid.
| Compound Name | (Z)-6-amino-7-[amino(cyclobutyl)amino]-3-[4-chloro-3-[[(4R)-4-ethyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]-2,2-dimethylhept-6-enoic acid |
|---|---|
| PubChem CID | 135142420 |
| Molecular Formula | C30H41ClN4O3S |
| Molecular Weight | 573.20 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (Z)-6-amino-7-[amino(cyclobutyl)amino]-3-[4-chloro-3-[[(4R)-4-ethyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]-2,2-dimethylhept-6-enoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CC/C(N)=C/N(N)C3CCC3)C(C)(C)C(=O)O)ccc2Cl)Sc2ccccc2O1 |
| InChI | InChI=1S/C30H41ClN4O3S/c1-4-24-19-34(39-28-11-6-5-10-27(28)38-24)17-21-16-20(12-15-26(21)31)25(30(2,3)29(36)37)14-13-22(32)18-35(33)23-8-7-9-23/h5-6,10-12,15-16,18,23-25H,4,7-9,13-14,17,19,32-33H2,1-3H3,(H,36,37)/b22-18-/t24-,25?/m1/s1 |
| InChIKey | PBMWMULKURMJJD-TVTWRNMCSA-N |
| XLogP | 6.52 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.20 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|