C20H24ClFN2O2 — CID 155178977
ethyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate (PubChem CID 155178977) has the molecular formula C20H24ClFN2O2 and a molecular weight of 378.88 g/mol. Its IUPAC name is ethyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 155178977 |
| Molecular Formula | C20H24ClFN2O2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | ethyl 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-[3-(chloromethyl)-4-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CC(c1ccc(F)c(CCl)c1)c1ccc(NC)c(N)c1C |
| InChI | InChI=1S/C20H24ClFN2O2/c1-4-26-19(25)10-16(13-5-7-17(22)14(9-13)11-21)15-6-8-18(24-3)20(23)12(15)2/h5-9,16,24H,4,10-11,23H2,1-3H3 |
| InChIKey | XKEKKCPNWMDINQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|