C22H31ClN2O2 — CID 145208371
1-N,3-dimethylbenzene-1,2-diamine;ethyl 3-[3-(chloromethyl)-4-methylphenyl]-2-methylpropanoate (PubChem CID 145208371) has the molecular formula C22H31ClN2O2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 1-N,3-dimethylbenzene-1,2-diamine;ethyl 3-[3-(chloromethyl)-4-methylphenyl]-2-methylpropanoate.
| Compound Name | 1-N,3-dimethylbenzene-1,2-diamine;ethyl 3-[3-(chloromethyl)-4-methylphenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 145208371 |
| Molecular Formula | C22H31ClN2O2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-N,3-dimethylbenzene-1,2-diamine;ethyl 3-[3-(chloromethyl)-4-methylphenyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)Cc1ccc(C)c(CCl)c1.CNc1cccc(C)c1N |
| InChI | InChI=1S/C14H19ClO2.C8H12N2/c1-4-17-14(16)11(3)7-12-6-5-10(2)13(8-12)9-15;1-6-4-3-5-7(10-2)8(6)9/h5-6,8,11H,4,7,9H2,1-3H3;3-5,10H,9H2,1-2H3 |
| InChIKey | NPWSASHRCRQNBT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|