C22H22O4 — CID 167499034
ethyl 2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoate (PubChem CID 167499034) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl 2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoate.
| Compound Name | ethyl 2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoate |
|---|---|
| PubChem CID | 167499034 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl 2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoate |
| SMILES | CCOC(=O)C(C)Cc1ccc2c(-c3ccccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22O4/c1-4-25-22(24)15(3)11-16-9-10-18-19(13-21(23)26-20(18)12-16)17-8-6-5-7-14(17)2/h5-10,12-13,15H,4,11H2,1-3H3 |
| InChIKey | PJQAYFOXOULPRD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|