About (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide
(2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide (PubChem CID 155099166) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide.
Molecular Properties
| Compound Name | (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide |
| PubChem CID | 155099166 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc([C@H](CO)C(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C21H21NO4/c1-13-6-4-5-7-15(13)17-11-20(24)26-19-10-14(8-9-16(17)19)18(12-23)21(25)22(2)3/h4-11,18,23H,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | PEFYCPITQKUDGG-SFHVURJKSA-N |
| XLogP | 2.93 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide?
The IUPAC name of (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide (CID 155099166) is (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide.
What is the SMILES notation for (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide?
The canonical SMILES for (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide is Cc1ccccc1-c1cc(=O)oc2cc([C@H](CO)C(=O)N(C)C)ccc12.
What is the InChIKey of (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide?
The InChIKey is PEFYCPITQKUDGG-SFHVURJKSA-N. The full InChI is InChI=1S/C21H21NO4/c1-13-6-4-5-7-15(13)17-11-20(24)26-19-10-14(8-9-16(17)19)18(12-23)21(25)22(2)3/h4-11,18,23H,12H2,1-3H3/t18-/m0/s1.
What are the key properties of (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide?
(2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide has a molecular weight of 351.40 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-hydroxy-N,N-dimethyl-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanamide is sourced from PubChem (CID 155099166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).