C26H26N2O3 — CID 167498952
(3S)-1-[2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoyl]piperidine-3-carbonitrile (PubChem CID 167498952) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is (3S)-1-[2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoyl]piperidine-3-carbonitrile.
| Compound Name | (3S)-1-[2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoyl]piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 167498952 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3S)-1-[2-methyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]propanoyl]piperidine-3-carbonitrile |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(CC(C)C(=O)N3CCC[C@H](C#N)C3)ccc12 |
| InChI | InChI=1S/C26H26N2O3/c1-17-6-3-4-8-21(17)23-14-25(29)31-24-13-19(9-10-22(23)24)12-18(2)26(30)28-11-5-7-20(15-27)16-28/h3-4,6,8-10,13-14,18,20H,5,7,11-12,16H2,1-2H3/t18?,20-/m1/s1 |
| InChIKey | RRUVDDMWKPGOIQ-ROPPNANJSA-N |
| XLogP | 4.71 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|