C26H27NO5 — CID 167498673
4-[methyl-[[4-(2-methylphenyl)-2-oxochromen-7-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 167498673) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4-[methyl-[[4-(2-methylphenyl)-2-oxochromen-7-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[methyl-[[4-(2-methylphenyl)-2-oxochromen-7-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167498673 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-[methyl-[[4-(2-methylphenyl)-2-oxochromen-7-yl]methyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(CN(C)C(=O)C3CCC(C(=O)O)CC3)ccc12 |
| InChI | InChI=1S/C26H27NO5/c1-16-5-3-4-6-20(16)22-14-24(28)32-23-13-17(7-12-21(22)23)15-27(2)25(29)18-8-10-19(11-9-18)26(30)31/h3-7,12-14,18-19H,8-11,15H2,1-2H3,(H,30,31) |
| InChIKey | KDFGICHXINDXPR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|