C23H24N2O5 — CID 167498923
2-methyl-2-[[2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetyl]amino]propanoic acid (PubChem CID 167498923) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-methyl-2-[[2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 167498923 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-methyl-2-[[2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetyl]amino]propanoic acid |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(N(C)CC(=O)NC(C)(C)C(=O)O)ccc12 |
| InChI | InChI=1S/C23H24N2O5/c1-14-7-5-6-8-16(14)18-12-21(27)30-19-11-15(9-10-17(18)19)25(4)13-20(26)24-23(2,3)22(28)29/h5-12H,13H2,1-4H3,(H,24,26)(H,28,29) |
| InChIKey | ISIACEFIEQNZQD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|