C21H21FN2O4 — CID 167499002
2-[[4-(5-fluoro-2-methylphenyl)-2-oxochromen-7-yl]-methylamino]-N-(2-hydroxyethyl)acetamide (PubChem CID 167499002) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-[[4-(5-fluoro-2-methylphenyl)-2-oxochromen-7-yl]-methylamino]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[[4-(5-fluoro-2-methylphenyl)-2-oxochromen-7-yl]-methylamino]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 167499002 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[4-(5-fluoro-2-methylphenyl)-2-oxochromen-7-yl]-methylamino]-N-(2-hydroxyethyl)acetamide |
| SMILES | Cc1ccc(F)cc1-c1cc(=O)oc2cc(N(C)CC(=O)NCCO)ccc12 |
| InChI | InChI=1S/C21H21FN2O4/c1-13-3-4-14(22)9-17(13)18-11-21(27)28-19-10-15(5-6-16(18)19)24(2)12-20(26)23-7-8-25/h3-6,9-11,25H,7-8,12H2,1-2H3,(H,23,26) |
| InChIKey | NWGSUGYWGXEHLL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|