C20H17B3N2O3 — CID 167498968
CID 167498968 (PubChem CID 167498968) has the molecular formula C20H17B3N2O3 and a molecular weight of 365.80 g/mol.
| Compound Name | CID 167498968 |
|---|---|
| PubChem CID | 167498968 |
| Molecular Formula | C20H17B3N2O3 |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)CN(C)c1ccc2c(-c3ccccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H17B3N2O3/c1-12-5-3-4-6-14(12)16-10-19(27)28-17-9-13(7-8-15(16)17)25(2)11-18(26)24-20(21,22)23/h3-10H,11H2,1-2H3,(H,24,26) |
| InChIKey | KLAVGGQQJSQJMC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|