C22H21NO3 — CID 167499207
N,N,2-trimethyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]prop-2-enamide (PubChem CID 167499207) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is N,N,2-trimethyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]prop-2-enamide.
| Compound Name | N,N,2-trimethyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167499207 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N,N,2-trimethyl-3-[4-(2-methylphenyl)-2-oxochromen-7-yl]prop-2-enamide |
| SMILES | CC(=Cc1ccc2c(-c3ccccc3C)cc(=O)oc2c1)C(=O)N(C)C |
| InChI | InChI=1S/C22H21NO3/c1-14-7-5-6-8-17(14)19-13-21(24)26-20-12-16(9-10-18(19)20)11-15(2)22(25)23(3)4/h5-13H,1-4H3 |
| InChIKey | DORJGTGCAKEJRU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|