C20H16O4 — CID 167498737
trans-(1S,2S)-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]cyclopropane-1-carboxylic acid (PubChem CID 167498737) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 167498737 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | trans-(1S,2S)-2-[4-(2-methylphenyl)-2-oxochromen-7-yl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc([C@H]3C[C@@H]3C(=O)O)ccc12 |
| InChI | InChI=1S/C20H16O4/c1-11-4-2-3-5-13(11)16-10-19(21)24-18-8-12(6-7-14(16)18)15-9-17(15)20(22)23/h2-8,10,15,17H,9H2,1H3,(H,22,23)/t15-,17+/m1/s1 |
| InChIKey | XEYIJXROALLPOG-WBVHZDCISA-N |
| XLogP | 3.96 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|