C20H19NO3 — CID 167499260
7-cyclopropyl-4-(2-methylphenyl)chromen-2-one;formamide (PubChem CID 167499260) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one;formamide.
| Compound Name | 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one;formamide |
|---|---|
| PubChem CID | 167499260 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 7-cyclopropyl-4-(2-methylphenyl)chromen-2-one;formamide |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(C3CC3)ccc12.NC=O |
| InChI | InChI=1S/C19H16O2.CH3NO/c1-12-4-2-3-5-15(12)17-11-19(20)21-18-10-14(13-6-7-13)8-9-16(17)18;2-1-3/h2-5,8-11,13H,6-7H2,1H3;1H,(H2,2,3) |
| InChIKey | PKLLITFGMJMNRF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|