About 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne
7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne (PubChem CID 167498907) has the molecular formula C21H18O3
and a molecular weight of 318.37 g/mol. Its IUPAC name is 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne.
Molecular Properties
| Compound Name | 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne |
| PubChem CID | 167498907 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne |
| SMILES | C#CC.Cc1ccccc1-c1cc(=O)oc2cc(/C=C/O)ccc12 |
| InChI | InChI=1S/C18H14O3.C3H4/c1-12-4-2-3-5-14(12)16-11-18(20)21-17-10-13(8-9-19)6-7-15(16)17;1-3-2/h2-11,19H,1H3;1H,2H3/b9-8+; |
| InChIKey | LFQIDXMQIXMMAJ-HRNDJLQDSA-N |
| XLogP | 4.94 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne?
The IUPAC name of 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne (CID 167498907) is 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne.
What is the SMILES notation for 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne?
The canonical SMILES for 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne is C#CC.Cc1ccccc1-c1cc(=O)oc2cc(/C=C/O)ccc12.
What is the InChIKey of 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne?
The InChIKey is LFQIDXMQIXMMAJ-HRNDJLQDSA-N. The full InChI is InChI=1S/C18H14O3.C3H4/c1-12-4-2-3-5-14(12)16-11-18(20)21-17-10-13(8-9-19)6-7-15(16)17;1-3-2/h2-11,19H,1H3;1H,2H3/b9-8+;.
What are the key properties of 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne?
7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne has a molecular weight of 318.37 g/mol, XLogP of 4.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(E)-2-hydroxyethenyl]-4-(2-methylphenyl)chromen-2-one;prop-1-yne is sourced from PubChem (CID 167498907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).