C23H25NO4 — CID 167498931
tert-butyl 2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetate (PubChem CID 167498931) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl 2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetate.
| Compound Name | tert-butyl 2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetate |
|---|---|
| PubChem CID | 167498931 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl 2-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]acetate |
| SMILES | Cc1ccccc1-c1cc(=O)oc2cc(N(C)CC(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C23H25NO4/c1-15-8-6-7-9-17(15)19-13-21(25)27-20-12-16(10-11-18(19)20)24(5)14-22(26)28-23(2,3)4/h6-13H,14H2,1-5H3 |
| InChIKey | CWTKZHYNMPPHKI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|