C23H25NO5 — CID 167498814
(2S)-2-(methoxymethyl)-2-methyl-3-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]propanoic acid (PubChem CID 167498814) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-2-methyl-3-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]propanoic acid.
| Compound Name | (2S)-2-(methoxymethyl)-2-methyl-3-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 167498814 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (2S)-2-(methoxymethyl)-2-methyl-3-[methyl-[4-(2-methylphenyl)-2-oxochromen-7-yl]amino]propanoic acid |
| SMILES | COC[C@](C)(CN(C)c1ccc2c(-c3ccccc3C)cc(=O)oc2c1)C(=O)O |
| InChI | InChI=1S/C23H25NO5/c1-15-7-5-6-8-17(15)19-12-21(25)29-20-11-16(9-10-18(19)20)24(3)13-23(2,14-28-4)22(26)27/h5-12H,13-14H2,1-4H3,(H,26,27)/t23-/m0/s1 |
| InChIKey | RJRCPYBFBGMTMW-QHCPKHFHSA-N |
| XLogP | 3.94 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|